C20H18N2O5S — CID 163695148
2-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)sulfinyl-1H-benzimidazole (PubChem CID 163695148) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)sulfinyl-1H-benzimidazole.
| Compound Name | 2-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)sulfinyl-1H-benzimidazole |
|---|---|
| PubChem CID | 163695148 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)sulfinyl-1H-benzimidazole |
| SMILES | COc1cc(S(=O)c2ccc3nc(-c4ccco4)[nH]c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H18N2O5S/c1-24-17-10-13(11-18(25-2)19(17)26-3)28(23)12-6-7-14-15(9-12)22-20(21-14)16-5-4-8-27-16/h4-11H,1-3H3,(H,21,22) |
| InChIKey | JWILUGSEYCGPSS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |