C15H24N2O — CID 163698473
2-methylimino-5-[(2E,4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]oxypentan-1-amine (PubChem CID 163698473) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-methylimino-5-[(2E,4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]oxypentan-1-amine.
| Compound Name | 2-methylimino-5-[(2E,4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]oxypentan-1-amine |
|---|---|
| PubChem CID | 163698473 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-methylimino-5-[(2E,4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]oxypentan-1-amine |
| SMILES | C=C=C/C(C)=C\C=C(/C)OCCC/C(CN)=N/C |
| InChI | InChI=1S/C15H24N2O/c1-5-7-13(2)9-10-14(3)18-11-6-8-15(12-16)17-4/h7,9-10H,1,6,8,11-12,16H2,2-4H3/b13-9-,14-10+,17-15- |
| InChIKey | JYXNENTUGJTOPR-VGCZPTDHSA-N |
| XLogP | 3.00 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|