C34H46N2OS2 — CID 163700260
2-tert-butyl-4-[4-[(7-ethyl-10H-phenothiazin-3-yl)amino]-2-methylbutyl]sulfanyl-6-(3-methylbutan-2-yl)phenol (PubChem CID 163700260) has the molecular formula C34H46N2OS2 and a molecular weight of 562.89 g/mol. Its IUPAC name is 2-tert-butyl-4-[4-[(7-ethyl-10H-phenothiazin-3-yl)amino]-2-methylbutyl]sulfanyl-6-(3-methylbutan-2-yl)phenol.
| Compound Name | 2-tert-butyl-4-[4-[(7-ethyl-10H-phenothiazin-3-yl)amino]-2-methylbutyl]sulfanyl-6-(3-methylbutan-2-yl)phenol |
|---|---|
| PubChem CID | 163700260 |
| Molecular Formula | C34H46N2OS2 |
| Molecular Weight | 562.89 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 2-tert-butyl-4-[4-[(7-ethyl-10H-phenothiazin-3-yl)amino]-2-methylbutyl]sulfanyl-6-(3-methylbutan-2-yl)phenol |
| SMILES | CCc1ccc2c(c1)Sc1cc(NCCC(C)CSc3cc(C(C)C(C)C)c(O)c(C(C)(C)C)c3)ccc1N2 |
| InChI | InChI=1S/C34H46N2OS2/c1-9-24-10-12-29-31(16-24)39-32-17-25(11-13-30(32)36-29)35-15-14-22(4)20-38-26-18-27(23(5)21(2)3)33(37)28(19-26)34(6,7)8/h10-13,16-19,21-23,35-37H,9,14-15,20H2,1-8H3 |
| InChIKey | KAJLNBJWBADOQR-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.89 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|