About 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone
2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone (PubChem CID 163701318) has the molecular formula C24H32N2O
and a molecular weight of 364.53 g/mol. Its IUPAC name is 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone.
Molecular Properties
| Compound Name | 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone |
| PubChem CID | 163701318 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone |
| SMILES | CC12CC3CC(c4ccccc4)(C1)CC2(C(=O)N1CCC2(CC1)CNC2)C3 |
| InChI | InChI=1S/C24H32N2O/c1-21-11-18-12-23(14-21,19-5-3-2-4-6-19)15-24(21,13-18)20(27)26-9-7-22(8-10-26)16-25-17-22/h2-6,18,25H,7-17H2,1H3 |
| InChIKey | KBGANNNACDVWJQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone?
The IUPAC name of 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone (CID 163701318) is 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone.
What is the SMILES notation for 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone?
The canonical SMILES for 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone is CC12CC3CC(c4ccccc4)(C1)CC2(C(=O)N1CCC2(CC1)CNC2)C3.
What is the InChIKey of 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone?
The InChIKey is KBGANNNACDVWJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2O/c1-21-11-18-12-23(14-21,19-5-3-2-4-6-19)15-24(21,13-18)20(27)26-9-7-22(8-10-26)16-25-17-22/h2-6,18,25H,7-17H2,1H3.
What are the key properties of 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone?
2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone has a molecular weight of 364.53 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diazaspiro[3.5]nonan-7-yl-(7-methyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanone is sourced from PubChem (CID 163701318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).