About 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide
7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 130268999) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide.
Molecular Properties
| Compound Name | 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| PubChem CID | 130268999 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | CC12CC3CC(c4ccccc4)(C1)CC2(C(=O)Nc1ccncc1)C3 |
| InChI | InChI=1S/C22H24N2O/c1-20-11-16-12-21(14-20,17-5-3-2-4-6-17)15-22(20,13-16)19(25)24-18-7-9-23-10-8-18/h2-10,16H,11-15H2,1H3,(H,23,24,25) |
| InChIKey | IUNXZXLDVHFJIA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The IUPAC name of 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide (CID 130268999) is 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide.
What is the SMILES notation for 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The canonical SMILES for 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide is CC12CC3CC(c4ccccc4)(C1)CC2(C(=O)Nc1ccncc1)C3.
What is the InChIKey of 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The InChIKey is IUNXZXLDVHFJIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O/c1-20-11-16-12-21(14-20,17-5-3-2-4-6-17)15-22(20,13-16)19(25)24-18-7-9-23-10-8-18/h2-10,16H,11-15H2,1H3,(H,23,24,25).
What are the key properties of 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide has a molecular weight of 332.45 g/mol, XLogP of 4.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1-phenyl-N-pyridin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide is sourced from PubChem (CID 130268999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).