C26H27NO2P+ — CID 163703060
1-[(18R)-13-methyl-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,19,21-nonaen-13-yl]piperidine (PubChem CID 163703060) has the molecular formula C26H27NO2P+ and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-[(18R)-13-methyl-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,19,21-nonaen-13-yl]piperidine.
| Compound Name | 1-[(18R)-13-methyl-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,19,21-nonaen-13-yl]piperidine |
|---|---|
| PubChem CID | 163703060 |
| Molecular Formula | C26H27NO2P+ |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[(18R)-13-methyl-12,14-dioxa-13-phosphoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,19,21-nonaen-13-yl]piperidine |
| SMILES | C[P+]1(N2CCCCC2)OC2=C(c3c(ccc4ccccc34)O1)C1C=CC=C[C@@H]1C=C2 |
| InChI | InChI=1S/C26H27NO2P/c1-30(27-17-7-2-8-18-27)28-23-15-13-19-9-3-5-11-21(19)25(23)26-22-12-6-4-10-20(22)14-16-24(26)29-30/h3-6,9-16,19,21H,2,7-8,17-18H2,1H3/q+1/t19-,21?,30?/m1/s1 |
| InChIKey | INNXHPLSGCNONN-WSNVNQLLSA-N |
| XLogP | 6.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|