C25H24ClFO6 — CID 163706868
7-[3-[2-chloro-4-(4-fluorophenoxy)phenoxy]propoxy]-3,4,4a,8a-tetrahydro-2H-chromene-2-carboxylic acid (PubChem CID 163706868) has the molecular formula C25H24ClFO6 and a molecular weight of 474.91 g/mol. Its IUPAC name is 7-[3-[2-chloro-4-(4-fluorophenoxy)phenoxy]propoxy]-3,4,4a,8a-tetrahydro-2H-chromene-2-carboxylic acid.
| Compound Name | 7-[3-[2-chloro-4-(4-fluorophenoxy)phenoxy]propoxy]-3,4,4a,8a-tetrahydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 163706868 |
| Molecular Formula | C25H24ClFO6 |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 7-[3-[2-chloro-4-(4-fluorophenoxy)phenoxy]propoxy]-3,4,4a,8a-tetrahydro-2H-chromene-2-carboxylic acid |
| SMILES | O=C(O)C1CCC2C=CC(OCCCOc3ccc(Oc4ccc(F)cc4)cc3Cl)=CC2O1 |
| InChI | InChI=1S/C25H24ClFO6/c26-21-14-20(32-18-7-4-17(27)5-8-18)9-11-22(21)31-13-1-12-30-19-6-2-16-3-10-23(25(28)29)33-24(16)15-19/h2,4-9,11,14-16,23-24H,1,3,10,12-13H2,(H,28,29) |
| InChIKey | KFVADVNZQOZSMJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|