C6H8FNO — CID 163709987
N-[(1E,3E)-3-fluoropenta-1,3-dienoxy]methanimine (PubChem CID 163709987) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is N-[(1E,3E)-3-fluoropenta-1,3-dienoxy]methanimine.
| Compound Name | N-[(1E,3E)-3-fluoropenta-1,3-dienoxy]methanimine |
|---|---|
| PubChem CID | 163709987 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | N-[(1E,3E)-3-fluoropenta-1,3-dienoxy]methanimine |
| SMILES | C=NO/C=C/C(F)=C\C |
| InChI | InChI=1S/C6H8FNO/c1-3-6(7)4-5-9-8-2/h3-5H,2H2,1H3/b5-4+,6-3+ |
| InChIKey | KIJHSVLMRICSQH-UTTVJGTNSA-N |
| XLogP | 2.01 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|