C9H8Cl4N4 — CID 163710683
1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine (PubChem CID 163710683) has the molecular formula C9H8Cl4N4 and a molecular weight of 314.00 g/mol. Its IUPAC name is 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine.
| Compound Name | 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 163710683 |
| Molecular Formula | C9H8Cl4N4 |
| Molecular Weight | 314.00 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine |
| SMILES | Clc1ccccc1C(Cl)(Cl)Cl.Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H4Cl4.C2H4N4/c8-6-4-2-1-3-5(6)7(9,10)11;3-2-4-1-5-6-2/h1-4H;1H,(H3,3,4,5,6) |
| InChIKey | KIYAIMZHKGKDKU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.00 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|