About 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine
1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine (PubChem CID 163710683) has the molecular formula C9H8Cl4N4
and a molecular weight of 314.00 g/mol. Its IUPAC name is 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine |
| PubChem CID | 163710683 |
| Molecular Formula | C9H8Cl4N4 |
| Molecular Weight | 314.00 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine |
| SMILES | Clc1ccccc1C(Cl)(Cl)Cl.Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H4Cl4.C2H4N4/c8-6-4-2-1-3-5(6)7(9,10)11;3-2-4-1-5-6-2/h1-4H;1H,(H3,3,4,5,6) |
| InChIKey | KIYAIMZHKGKDKU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.00 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine?
The IUPAC name of 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine (CID 163710683) is 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine?
The canonical SMILES for 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine is Clc1ccccc1C(Cl)(Cl)Cl.Nc1ncn[nH]1.
What is the InChIKey of 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine?
The InChIKey is KIYAIMZHKGKDKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl4.C2H4N4/c8-6-4-2-1-3-5(6)7(9,10)11;3-2-4-1-5-6-2/h1-4H;1H,(H3,3,4,5,6).
What are the key properties of 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine?
1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine has a molecular weight of 314.00 g/mol, XLogP of 3.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(trichloromethyl)benzene;1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 163710683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).