C6H5Cl2NO — CID 163711019
2,4-dichloro-1,2-dihydropyridine-3-carbaldehyde (PubChem CID 163711019) has the molecular formula C6H5Cl2NO and a molecular weight of 178.02 g/mol. Its IUPAC name is 2,4-dichloro-1,2-dihydropyridine-3-carbaldehyde.
| Compound Name | 2,4-dichloro-1,2-dihydropyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 163711019 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | 2,4-dichloro-1,2-dihydropyridine-3-carbaldehyde |
| SMILES | O=CC1=C(Cl)C=CNC1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c7-5-1-2-9-6(8)4(5)3-10/h1-3,6,9H |
| InChIKey | KJFJMUGWUOENAG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|