C9H12F3NO — CID 164602671
ethane;2-(trifluoromethyl)-1,2-dihydropyridine-4-carbaldehyde (PubChem CID 164602671) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is ethane;2-(trifluoromethyl)-1,2-dihydropyridine-4-carbaldehyde.
| Compound Name | ethane;2-(trifluoromethyl)-1,2-dihydropyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 164602671 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | ethane;2-(trifluoromethyl)-1,2-dihydropyridine-4-carbaldehyde |
| SMILES | CC.O=CC1=CC(C(F)(F)F)NC=C1 |
| InChI | InChI=1S/C7H6F3NO.C2H6/c8-7(9,10)6-3-5(4-12)1-2-11-6;1-2/h1-4,6,11H;1-2H3 |
| InChIKey | JCSSCXHPPIJJID-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|