C9H8OS — CID 112711982
3a,7a-dihydro-1-benzothiophene-6-carbaldehyde (PubChem CID 112711982) has the molecular formula C9H8OS and a molecular weight of 164.23 g/mol. Its IUPAC name is 3a,7a-dihydro-1-benzothiophene-6-carbaldehyde.
| Compound Name | 3a,7a-dihydro-1-benzothiophene-6-carbaldehyde |
|---|---|
| PubChem CID | 112711982 |
| Molecular Formula | C9H8OS |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 3a,7a-dihydro-1-benzothiophene-6-carbaldehyde |
| SMILES | O=CC1=CC2SC=CC2C=C1 |
| InChI | InChI=1S/C9H8OS/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-6,8-9H |
| InChIKey | SYWNHLJFYKYJBU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|