C16H29NO3S — CID 163713433
cis-(1S,2S)-N-(1-methylcyclopropyl)sulfonyl-2-octan-2-ylcyclopropane-1-carboxamide (PubChem CID 163713433) has the molecular formula C16H29NO3S and a molecular weight of 315.48 g/mol. Its IUPAC name is cis-(1S,2S)-N-(1-methylcyclopropyl)sulfonyl-2-octan-2-ylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-(1-methylcyclopropyl)sulfonyl-2-octan-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 163713433 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | cis-(1S,2S)-N-(1-methylcyclopropyl)sulfonyl-2-octan-2-ylcyclopropane-1-carboxamide |
| SMILES | CCCCCCC(C)[C@@H]1C[C@@H]1C(=O)NS(=O)(=O)C1(C)CC1 |
| InChI | InChI=1S/C16H29NO3S/c1-4-5-6-7-8-12(2)13-11-14(13)15(18)17-21(19,20)16(3)9-10-16/h12-14H,4-11H2,1-3H3,(H,17,18)/t12?,13-,14-/m0/s1 |
| InChIKey | KLGMQAPWVRWTSF-TTZKSVMKSA-N |
| XLogP | 3.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|