C21H13FO2S — CID 163716297
3-(4-fluorophenyl)-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2,5,7,9,12,14-heptaene 11,11-dioxide (PubChem CID 163716297) has the molecular formula C21H13FO2S and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2,5,7,9,12,14-heptaene 11,11-dioxide.
| Compound Name | 3-(4-fluorophenyl)-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2,5,7,9,12,14-heptaene 11,11-dioxide |
|---|---|
| PubChem CID | 163716297 |
| Molecular Formula | C21H13FO2S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-(4-fluorophenyl)-11λ6-thiatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),2,5,7,9,12,14-heptaene 11,11-dioxide |
| SMILES | O=S1(=O)c2ccccc2C2=C(c3ccc(F)cc3)C2c2ccccc21 |
| InChI | InChI=1S/C21H13FO2S/c22-14-11-9-13(10-12-14)19-20-15-5-1-3-7-17(15)25(23,24)18-8-4-2-6-16(18)21(19)20/h1-12,20H |
| InChIKey | KNQPVWICMXEBJW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|