C23H26N4O8 — CID 163717963
2-(4-amino-2-nitrophenoxy)ethyl (E)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobut-2-enoate (PubChem CID 163717963) has the molecular formula C23H26N4O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is 2-(4-amino-2-nitrophenoxy)ethyl (E)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobut-2-enoate.
| Compound Name | 2-(4-amino-2-nitrophenoxy)ethyl (E)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 163717963 |
| Molecular Formula | C23H26N4O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-(4-amino-2-nitrophenoxy)ethyl (E)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]anilino]-4-oxobut-2-enoate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)/C=C/C(=O)OCCOc1ccc(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26N4O8/c1-23(2,3)35-22(30)26-17-7-5-4-6-16(17)25-20(28)10-11-21(29)34-13-12-33-19-9-8-15(24)14-18(19)27(31)32/h4-11,14H,12-13,24H2,1-3H3,(H,25,28)(H,26,30)/b11-10+ |
| InChIKey | KOZWLJRTTVZVNH-ZHACJKMWSA-N |
| XLogP | 3.64 |
| TPSA | 172.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|