C21H20O2 — CID 163731973
1-anthracen-1-ylethenyl 2,2-dimethylpropanoate (PubChem CID 163731973) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-anthracen-1-ylethenyl 2,2-dimethylpropanoate.
| Compound Name | 1-anthracen-1-ylethenyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163731973 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-anthracen-1-ylethenyl 2,2-dimethylpropanoate |
| SMILES | C=C(OC(=O)C(C)(C)C)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C21H20O2/c1-14(23-20(22)21(2,3)4)18-11-7-10-17-12-15-8-5-6-9-16(15)13-19(17)18/h5-13H,1H2,2-4H3 |
| InChIKey | LAIQVAHXLXJINS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|