C21H24INO6 — CID 163739369
4-[1-[iodo(methyl)amino]-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]oxy-4-oxobutanoic acid (PubChem CID 163739369) has the molecular formula C21H24INO6 and a molecular weight of 513.33 g/mol. Its IUPAC name is 4-[1-[iodo(methyl)amino]-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[1-[iodo(methyl)amino]-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 163739369 |
| Molecular Formula | C21H24INO6 |
| Molecular Weight | 513.33 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 4-[1-[iodo(methyl)amino]-3-[4-(4-methoxyphenyl)phenoxy]propan-2-yl]oxy-4-oxobutanoic acid |
| SMILES | COc1ccc(-c2ccc(OCC(CN(C)I)OC(=O)CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H24INO6/c1-23(22)13-19(29-21(26)12-11-20(24)25)14-28-18-9-5-16(6-10-18)15-3-7-17(27-2)8-4-15/h3-10,19H,11-14H2,1-2H3,(H,24,25) |
| InChIKey | LGKUZSFFBGVHRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|