C14H30N4 — CID 163742795
N-amino-N-[2-[(E,2R,4E)-4-ethylidene-5-methyl-3-propylhept-5-en-2-yl]hydrazinyl]methanamine (PubChem CID 163742795) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is N-amino-N-[2-[(E,2R,4E)-4-ethylidene-5-methyl-3-propylhept-5-en-2-yl]hydrazinyl]methanamine.
| Compound Name | N-amino-N-[2-[(E,2R,4E)-4-ethylidene-5-methyl-3-propylhept-5-en-2-yl]hydrazinyl]methanamine |
|---|---|
| PubChem CID | 163742795 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | N-amino-N-[2-[(E,2R,4E)-4-ethylidene-5-methyl-3-propylhept-5-en-2-yl]hydrazinyl]methanamine |
| SMILES | C/C=C(C)/C(=C/C)C(CCC)[C@@H](C)NNN(C)N |
| InChI | InChI=1S/C14H30N4/c1-7-10-14(12(5)16-17-18(6)15)13(9-3)11(4)8-2/h8-9,12,14,16-17H,7,10,15H2,1-6H3/b11-8+,13-9-/t12-,14?/m1/s1 |
| InChIKey | LJGADEPQWMGJEL-MPBVYPCQSA-N |
| XLogP | 2.52 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|