C21H37N3O7S — CID 163747813
[3-[(1,1-dioxothian-4-yl)carbamoyl]-5-oxo-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] nitrate (PubChem CID 163747813) has the molecular formula C21H37N3O7S and a molecular weight of 475.61 g/mol. Its IUPAC name is [3-[(1,1-dioxothian-4-yl)carbamoyl]-5-oxo-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] nitrate.
| Compound Name | [3-[(1,1-dioxothian-4-yl)carbamoyl]-5-oxo-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] nitrate |
|---|---|
| PubChem CID | 163747813 |
| Molecular Formula | C21H37N3O7S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [3-[(1,1-dioxothian-4-yl)carbamoyl]-5-oxo-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] nitrate |
| SMILES | CN1C(C)(C)CC(C(=O)CC(CCO[N+](=O)[O-])C(=O)NC2CCS(=O)(=O)CC2)CC1(C)C |
| InChI | InChI=1S/C21H37N3O7S/c1-20(2)13-16(14-21(3,4)23(20)5)18(25)12-15(6-9-31-24(27)28)19(26)22-17-7-10-32(29,30)11-8-17/h15-17H,6-14H2,1-5H3,(H,22,26) |
| InChIKey | RCPSNHNYMAVKDW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|