C15H29N2O4S+ — CID 164982584
[4-[(1,1-dioxothian-4-yl)carbamoyl]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium (PubChem CID 164982584) has the molecular formula C15H29N2O4S+ and a molecular weight of 333.47 g/mol. Its IUPAC name is [4-[(1,1-dioxothian-4-yl)carbamoyl]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium.
| Compound Name | [4-[(1,1-dioxothian-4-yl)carbamoyl]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 164982584 |
| Molecular Formula | C15H29N2O4S+ |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | [4-[(1,1-dioxothian-4-yl)carbamoyl]-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
| SMILES | CC1(C)CC(C(=O)NC2CCS(=O)(=O)CC2)CC(C)(C)N1[OH2+] |
| InChI | InChI=1S/C15H28N2O4S/c1-14(2)9-11(10-15(3,4)17(14)19)13(18)16-12-5-7-22(20,21)8-6-12/h11-12,19H,5-10H2,1-4H3,(H,16,18)/p+1 |
| InChIKey | FSACWIZAEBXCFY-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|