C25H37N7O12-4 — CID 163748038
4-oxo-5-[4,7,10-tris[2-(carboxylatomethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoate (PubChem CID 163748038) has the molecular formula C25H37N7O12-4 and a molecular weight of 627.61 g/mol. Its IUPAC name is 4-oxo-5-[4,7,10-tris[2-(carboxylatomethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoate.
| Compound Name | 4-oxo-5-[4,7,10-tris[2-(carboxylatomethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoate |
|---|---|
| PubChem CID | 163748038 |
| Molecular Formula | C25H37N7O12-4 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | 4-oxo-5-[4,7,10-tris[2-(carboxylatomethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoate |
| SMILES | O=C([O-])CCC(=O)CN1CCN(CC(=O)NCC(=O)[O-])CCN(CC(=O)NCC(=O)[O-])CCN(CC(=O)NCC(=O)[O-])CC1 |
| InChI | InChI=1S/C25H41N7O12/c33-18(1-2-22(37)38)14-29-3-5-30(15-19(34)26-11-23(39)40)7-9-32(17-21(36)28-13-25(43)44)10-8-31(6-4-29)16-20(35)27-12-24(41)42/h1-17H2,(H,26,34)(H,27,35)(H,28,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)/p-4 |
| InChIKey | LNPGUGURSYVDSL-UHFFFAOYSA-J |
| XLogP | -10.09 |
| TPSA | 277.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | -10.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |