About CID 163750901
CID 163750901 (PubChem CID 163750901) has the molecular formula C20H27INO3-
and a molecular weight of 456.34 g/mol.
Molecular Properties
| Compound Name | CID 163750901 |
| PubChem CID | 163750901 |
| Molecular Formula | C20H27INO3- |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1[I-]C[C@@]23CCCC[C@@H]2[C@@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C20H27INO3/c1-19(2,3)25-18(24)22-17-10-13-7-8-14(23)11-16(13)20(12-21-22)9-5-4-6-15(17)20/h7-8,11,15,17,23H,4-6,9-10,12H2,1-3H3/q-1/t15-,17+,20+/m1/s1 |
| InChIKey | STYGQOOKKWXRBH-SYNHAJSKSA-N |
| XLogP | 1.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 163750901 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163750901?
The IUPAC name of CID 163750901 (CID 163750901) is not available.
What is the SMILES notation for CID 163750901?
The canonical SMILES for CID 163750901 is CC(C)(C)OC(=O)N1[I-]C[C@@]23CCCC[C@@H]2[C@@H]1Cc1ccc(O)cc13.
What is the InChIKey of CID 163750901?
The InChIKey is STYGQOOKKWXRBH-SYNHAJSKSA-N. The full InChI is InChI=1S/C20H27INO3/c1-19(2,3)25-18(24)22-17-10-13-7-8-14(23)11-16(13)20(12-21-22)9-5-4-6-15(17)20/h7-8,11,15,17,23H,4-6,9-10,12H2,1-3H3/q-1/t15-,17+,20+/m1/s1.
What are the key properties of CID 163750901?
CID 163750901 has a molecular weight of 456.34 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163750901 is sourced from PubChem (CID 163750901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).