C20H27INO3- — CID 163750901
CID 163750901 (PubChem CID 163750901) has the molecular formula C20H27INO3- and a molecular weight of 456.34 g/mol.
| Compound Name | CID 163750901 |
|---|---|
| PubChem CID | 163750901 |
| Molecular Formula | C20H27INO3- |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1[I-]C[C@@]23CCCC[C@@H]2[C@@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C20H27INO3/c1-19(2,3)25-18(24)22-17-10-13-7-8-14(23)11-16(13)20(12-21-22)9-5-4-6-15(17)20/h7-8,11,15,17,23H,4-6,9-10,12H2,1-3H3/q-1/t15-,17+,20+/m1/s1 |
| InChIKey | STYGQOOKKWXRBH-SYNHAJSKSA-N |
| XLogP | 1.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|