About 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine
8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine (PubChem CID 163752912) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine |
| PubChem CID | 163752912 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine |
| SMILES | CC1=CN2C=CC=C(F)C2N1C |
| InChI | InChI=1S/C9H11FN2/c1-7-6-12-5-3-4-8(10)9(12)11(7)2/h3-6,9H,1-2H3 |
| InChIKey | LROOHYPEXLMRQP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine?
The IUPAC name of 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine (CID 163752912) is 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine.
What is the SMILES notation for 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine?
The canonical SMILES for 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine is CC1=CN2C=CC=C(F)C2N1C.
What is the InChIKey of 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine?
The InChIKey is LROOHYPEXLMRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2/c1-7-6-12-5-3-4-8(10)9(12)11(7)2/h3-6,9H,1-2H3.
What are the key properties of 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine?
8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine has a molecular weight of 166.20 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-1,2-dimethyl-8aH-imidazo[1,2-a]pyridine is sourced from PubChem (CID 163752912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).