About 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine
8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine (PubChem CID 166888451) has the molecular formula C8H9FN2
and a molecular weight of 152.17 g/mol. Its IUPAC name is 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine |
| PubChem CID | 166888451 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine |
| SMILES | CN1C=C2C(F)=CC=CN2C1 |
| InChI | InChI=1S/C8H9FN2/c1-10-5-8-7(9)3-2-4-11(8)6-10/h2-5H,6H2,1H3 |
| InChIKey | OXZXIWYHCYRDJA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine?
The IUPAC name of 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine (CID 166888451) is 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine.
What is the SMILES notation for 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine?
The canonical SMILES for 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine is CN1C=C2C(F)=CC=CN2C1.
What is the InChIKey of 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine?
The InChIKey is OXZXIWYHCYRDJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2/c1-10-5-8-7(9)3-2-4-11(8)6-10/h2-5H,6H2,1H3.
What are the key properties of 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine?
8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine has a molecular weight of 152.17 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2-methyl-3H-imidazo[1,5-a]pyridine is sourced from PubChem (CID 166888451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).