C33H35N3 — CID 163753895
4-[(2-aminonaphthalen-1-yl)-(1-phenylethenyl)amino]-3,5-bis(2-methylpropyl)benzonitrile (PubChem CID 163753895) has the molecular formula C33H35N3 and a molecular weight of 473.66 g/mol. Its IUPAC name is 4-[(2-aminonaphthalen-1-yl)-(1-phenylethenyl)amino]-3,5-bis(2-methylpropyl)benzonitrile.
| Compound Name | 4-[(2-aminonaphthalen-1-yl)-(1-phenylethenyl)amino]-3,5-bis(2-methylpropyl)benzonitrile |
|---|---|
| PubChem CID | 163753895 |
| Molecular Formula | C33H35N3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 4-[(2-aminonaphthalen-1-yl)-(1-phenylethenyl)amino]-3,5-bis(2-methylpropyl)benzonitrile |
| SMILES | C=C(c1ccccc1)N(c1c(CC(C)C)cc(C#N)cc1CC(C)C)c1c(N)ccc2ccccc12 |
| InChI | InChI=1S/C33H35N3/c1-22(2)17-28-19-25(21-34)20-29(18-23(3)4)32(28)36(24(5)26-11-7-6-8-12-26)33-30-14-10-9-13-27(30)15-16-31(33)35/h6-16,19-20,22-23H,5,17-18,35H2,1-4H3 |
| InChIKey | LSJJUKFTPAPGHK-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|