C13H18FN4O13P3 — CID 163764376
[(3S,4S)-3-(2-amino-4-oxo-7,8-dihydro-3H-pyrido[3,2-d]pyrimidin-7-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.1]heptan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 163764376) has the molecular formula C13H18FN4O13P3 and a molecular weight of 550.22 g/mol. Its IUPAC name is [(3S,4S)-3-(2-amino-4-oxo-7,8-dihydro-3H-pyrido[3,2-d]pyrimidin-7-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.1]heptan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(3S,4S)-3-(2-amino-4-oxo-7,8-dihydro-3H-pyrido[3,2-d]pyrimidin-7-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.1]heptan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 163764376 |
| Molecular Formula | C13H18FN4O13P3 |
| Molecular Weight | 550.22 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | [(3S,4S)-3-(2-amino-4-oxo-7,8-dihydro-3H-pyrido[3,2-d]pyrimidin-7-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.1]heptan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1nc2c(c(=O)[nH]1)N=CC([C@@H]1OC3CC(O)(C3OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1F)C2 |
| InChI | InChI=1S/C13H18FN4O13P3/c14-9-8(4-1-5-7(16-3-4)11(19)18-12(15)17-5)28-6-2-13(9,20)10(6)29-33(24,25)31-34(26,27)30-32(21,22)23/h3-4,6,8-10,20H,1-2H2,(H,24,25)(H,26,27)(H2,21,22,23)(H3,15,17,18,19)/t4?,6?,8-,9-,10?,13?/m0/s1 |
| InChIKey | MAZFQUARYMRVNL-LCFMCKONSA-N |
| XLogP | -0.82 |
| TPSA | 273.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|