C11H14N6 — CID 163765987
2-hydrazinylidene-3-pyrrolo[2,3-d]pyrimidin-7-ylpentan-1-imine (PubChem CID 163765987) has the molecular formula C11H14N6 and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-hydrazinylidene-3-pyrrolo[2,3-d]pyrimidin-7-ylpentan-1-imine.
| Compound Name | 2-hydrazinylidene-3-pyrrolo[2,3-d]pyrimidin-7-ylpentan-1-imine |
|---|---|
| PubChem CID | 163765987 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-hydrazinylidene-3-pyrrolo[2,3-d]pyrimidin-7-ylpentan-1-imine |
| SMILES | [H]/N=C/C(=NN)C(CC)n1ccc2cncnc21 |
| InChI | InChI=1S/C11H14N6/c1-2-10(9(5-12)16-13)17-4-3-8-6-14-7-15-11(8)17/h3-7,10,12H,2,13H2,1H3/b12-5+,16-9? |
| InChIKey | REJKXUMPMXTGBT-OKJBZKCTSA-N |
| XLogP | 1.35 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|