C24H33N5O3 — CID 163775620
1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-(propylamino)ethyl]-3a,7a-dihydroindol-5-yl]urea (PubChem CID 163775620) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-(propylamino)ethyl]-3a,7a-dihydroindol-5-yl]urea.
| Compound Name | 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-(propylamino)ethyl]-3a,7a-dihydroindol-5-yl]urea |
|---|---|
| PubChem CID | 163775620 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-(propylamino)ethyl]-3a,7a-dihydroindol-5-yl]urea |
| SMILES | [H]/N=C(\c1cc(C(C)C)c(O)cc1O)N(C(N)=O)C1=CC2C=CN(CCNCCC)C2C=C1 |
| InChI | InChI=1S/C24H33N5O3/c1-4-8-27-9-11-28-10-7-16-12-17(5-6-20(16)28)29(24(26)32)23(25)19-13-18(15(2)3)21(30)14-22(19)31/h5-7,10,12-16,20,25,27,30-31H,4,8-9,11H2,1-3H3,(H2,26,32)/b25-23+ |
| InChIKey | MKEGKNWHLYWLMM-WJTDDFOZSA-N |
| XLogP | 3.19 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|