C24H38F3N5O3 — CID 90915476
2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[4-(diethylamino)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 90915476) has the molecular formula C24H38F3N5O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is 2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[4-(diethylamino)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[4-(diethylamino)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 90915476 |
| Molecular Formula | C24H38F3N5O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-[4-(diethylamino)cyclohexyl]amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(C1CCC(N(CC)CC)CC1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C24H38F3N5O3/c1-5-31(6-2)15-7-9-16(10-8-15)32(22(29)23(35)30-13-24(25,26)27)21(28)18-11-17(14(3)4)19(33)12-20(18)34/h11-12,14-16,21,29,33-34H,5-10,13,28H2,1-4H3,(H,30,35)/b29-22+ |
| InChIKey | XFUDDTAOWRDHMS-QUPMIFSKSA-N |
| XLogP | 3.79 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|