C26H34F4N6O3 — CID 91164727
2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 91164727) has the molecular formula C26H34F4N6O3 and a molecular weight of 554.59 g/mol. Its IUPAC name is 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 91164727 |
| Molecular Formula | C26H34F4N6O3 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 2-[N-[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]anilino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(c1ccc(CN2CCN(C)CC2)c(F)c1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C26H34F4N6O3/c1-15(2)18-11-19(22(38)12-21(18)37)23(31)36(24(32)25(39)33-14-26(28,29)30)17-5-4-16(20(27)10-17)13-35-8-6-34(3)7-9-35/h4-5,10-12,15,23,32,37-38H,6-9,13-14,31H2,1-3H3,(H,33,39)/b32-24+ |
| InChIKey | ARPNCLGOOMYORV-FEZSWGLMSA-N |
| XLogP | 3.23 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|