C25H38F3N5O3 — CID 91419804
2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(4-piperidin-1-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 91419804) has the molecular formula C25H38F3N5O3 and a molecular weight of 513.61 g/mol. Its IUPAC name is 2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(4-piperidin-1-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(4-piperidin-1-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 91419804 |
| Molecular Formula | C25H38F3N5O3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 2-[[amino-(2,4-dihydroxy-5-propan-2-ylphenyl)methyl]-(4-piperidin-1-ylcyclohexyl)amino]-2-imino-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | [H]/N=C(\C(=O)NCC(F)(F)F)N(C1CCC(N2CCCCC2)CC1)C(N)c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C25H38F3N5O3/c1-15(2)18-12-19(21(35)13-20(18)34)22(29)33(23(30)24(36)31-14-25(26,27)28)17-8-6-16(7-9-17)32-10-4-3-5-11-32/h12-13,15-17,22,30,34-35H,3-11,14,29H2,1-2H3,(H,31,36)/b30-23+ |
| InChIKey | HJKLSNGPABBRNI-JJKYIXSRSA-N |
| XLogP | 3.93 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|