C16H10Cl2O — CID 163779866
(4S)-4-(3,4-dichlorophenyl)-4H-naphthalen-1-one (PubChem CID 163779866) has the molecular formula C16H10Cl2O and a molecular weight of 289.16 g/mol. Its IUPAC name is (4S)-4-(3,4-dichlorophenyl)-4H-naphthalen-1-one.
| Compound Name | (4S)-4-(3,4-dichlorophenyl)-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 163779866 |
| Molecular Formula | C16H10Cl2O |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (4S)-4-(3,4-dichlorophenyl)-4H-naphthalen-1-one |
| SMILES | O=C1C=C[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C16H10Cl2O/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-9,11H/t11-/m0/s1 |
| InChIKey | MNSMGQRFMXXKKH-NSHDSACASA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |