C21H21ClOSi — CID 122206566
(6E,9Z)-8-(4-chlorophenyl)-7-trimethylsilyl-8H-benzo[8]annulen-5-one (PubChem CID 122206566) has the molecular formula C21H21ClOSi and a molecular weight of 352.94 g/mol. Its IUPAC name is (6E,9Z)-8-(4-chlorophenyl)-7-trimethylsilyl-8H-benzo[8]annulen-5-one.
| Compound Name | (6E,9Z)-8-(4-chlorophenyl)-7-trimethylsilyl-8H-benzo[8]annulen-5-one |
|---|---|
| PubChem CID | 122206566 |
| Molecular Formula | C21H21ClOSi |
| Molecular Weight | 352.94 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (6E,9Z)-8-(4-chlorophenyl)-7-trimethylsilyl-8H-benzo[8]annulen-5-one |
| SMILES | C[Si](C)(C)/C1=C/C(=O)c2ccccc2/C=C\C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClOSi/c1-24(2,3)21-14-20(23)18-7-5-4-6-15(18)10-13-19(21)16-8-11-17(22)12-9-16/h4-14,19H,1-3H3/b13-10-,21-14+ |
| InChIKey | PWRJQZRUYWOPIH-YBVHWPNFSA-N |
| XLogP | 6.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.94 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|