C13H20IN5S — CID 163785033
[[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate (PubChem CID 163785033) has the molecular formula C13H20IN5S and a molecular weight of 405.31 g/mol. Its IUPAC name is [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate.
| Compound Name | [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 163785033 |
| Molecular Formula | C13H20IN5S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate |
| SMILES | [H]/N=C(/SC(/N=N/c1ccc(N(C)C)cc1)=I\C)N(C)C |
| InChI | InChI=1S/C13H20IN5S/c1-14-12(20-13(15)19(4)5)17-16-10-6-8-11(9-7-10)18(2)3/h6-9,15H,1-5H3/b15-13+,17-16+ |
| InChIKey | IRWOHHNPSBDWFX-TZSXFDEBSA-N |
| XLogP | 3.75 |
| TPSA | 55.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|