About [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate
[[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate (PubChem CID 163785033) has the molecular formula C13H20IN5S
and a molecular weight of 405.31 g/mol. Its IUPAC name is [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate.
Molecular Properties
| Compound Name | [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate |
| PubChem CID | 163785033 |
| Molecular Formula | C13H20IN5S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate |
| SMILES | [H]/N=C(/SC(/N=N/c1ccc(N(C)C)cc1)=I\C)N(C)C |
| InChI | InChI=1S/C13H20IN5S/c1-14-12(20-13(15)19(4)5)17-16-10-6-8-11(9-7-10)18(2)3/h6-9,15H,1-5H3/b15-13+,17-16+ |
| InChIKey | IRWOHHNPSBDWFX-TZSXFDEBSA-N |
| XLogP | 3.75 |
| TPSA | 55.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate?
The IUPAC name of [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate (CID 163785033) is [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate.
What is the SMILES notation for [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate?
The canonical SMILES for [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate is [H]/N=C(/SC(/N=N/c1ccc(N(C)C)cc1)=I\C)N(C)C.
What is the InChIKey of [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate?
The InChIKey is IRWOHHNPSBDWFX-TZSXFDEBSA-N. The full InChI is InChI=1S/C13H20IN5S/c1-14-12(20-13(15)19(4)5)17-16-10-6-8-11(9-7-10)18(2)3/h6-9,15H,1-5H3/b15-13+,17-16+.
What are the key properties of [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate?
[[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate has a molecular weight of 405.31 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[[4-(dimethylamino)phenyl]diazenyl]-(methyl-λ3-iodanylidene)methyl] N,N-dimethylcarbamimidothioate is sourced from PubChem (CID 163785033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).