C14H19NO2S — CID 163792934
3-methyl-13-thia-3-azatetracyclo[8.3.1.18,12.01,7]pentadecane-4,6-dione (PubChem CID 163792934) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-methyl-13-thia-3-azatetracyclo[8.3.1.18,12.01,7]pentadecane-4,6-dione.
| Compound Name | 3-methyl-13-thia-3-azatetracyclo[8.3.1.18,12.01,7]pentadecane-4,6-dione |
|---|---|
| PubChem CID | 163792934 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-methyl-13-thia-3-azatetracyclo[8.3.1.18,12.01,7]pentadecane-4,6-dione |
| SMILES | CN1CC23CC4CC(CC(C4)C2C(=O)CC1=O)S3 |
| InChI | InChI=1S/C14H19NO2S/c1-15-7-14-6-8-2-9(4-10(3-8)18-14)13(14)11(16)5-12(15)17/h8-10,13H,2-7H2,1H3 |
| InChIKey | MYJKDPVQHLJAMJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|