About 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium
1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium (PubChem CID 163793076) has the molecular formula C12H24OOs-2
and a molecular weight of 374.55 g/mol. Its IUPAC name is 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium.
Molecular Properties
| Compound Name | 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium |
| PubChem CID | 163793076 |
| Molecular Formula | C12H24OOs-2 |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium |
| SMILES | C[C-](C)C.O=[Os].[CH2-]C1(C)CCCCC1 |
| InChI | InChI=1S/C8H15.C4H9.O.Os/c1-8(2)6-4-3-5-7-8;1-4(2)3;;/h1,3-7H2,2H3;1-3H3;;/q2*-1;; |
| InChIKey | MKXSVTVUIMRKSK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium?
The IUPAC name of 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium (CID 163793076) is 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium.
What is the SMILES notation for 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium?
The canonical SMILES for 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium is C[C-](C)C.O=[Os].[CH2-]C1(C)CCCCC1.
What is the InChIKey of 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium?
The InChIKey is MKXSVTVUIMRKSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15.C4H9.O.Os/c1-8(2)6-4-3-5-7-8;1-4(2)3;;/h1,3-7H2,2H3;1-3H3;;/q2*-1;;.
What are the key properties of 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium?
1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium has a molecular weight of 374.55 g/mol, XLogP of 4.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-1-methylcyclohexane;2-methylpropane;oxoosmium is sourced from PubChem (CID 163793076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).