C6H10O2 — CID 163794805
(2S)-2,5-dimethyl-2,3-dihydrofuran-4-ol (PubChem CID 163794805) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (2S)-2,5-dimethyl-2,3-dihydrofuran-4-ol.
| Compound Name | (2S)-2,5-dimethyl-2,3-dihydrofuran-4-ol |
|---|---|
| PubChem CID | 163794805 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (2S)-2,5-dimethyl-2,3-dihydrofuran-4-ol |
| SMILES | CC1=C(O)C[C@H](C)O1 |
| InChI | InChI=1S/C6H10O2/c1-4-3-6(7)5(2)8-4/h4,7H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | TWRGTNSJAIAGJN-BYPYZUCNSA-N |
| XLogP | 1.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |