C10H21N2O4S- — CID 163794858
3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate (PubChem CID 163794858) has the molecular formula C10H21N2O4S- and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate.
| Compound Name | 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate |
|---|---|
| PubChem CID | 163794858 |
| Molecular Formula | C10H21N2O4S- |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1-sulfinate |
| SMILES | CN(C)CC(CS(=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N2O4S/c1-10(2,3)16-9(13)11-8(6-12(4)5)7-17(14)15/h8H,6-7H2,1-5H3,(H,11,13)(H,14,15)/p-1 |
| InChIKey | PNMYKHADDJMKHO-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|