C5H8N5O3+ — CID 163798365
(2-amino-4,6-dioxo-1H-pyrimidin-5-yl)carbamoylazanium (PubChem CID 163798365) has the molecular formula C5H8N5O3+ and a molecular weight of 186.15 g/mol. Its IUPAC name is (2-amino-4,6-dioxo-1H-pyrimidin-5-yl)carbamoylazanium.
| Compound Name | (2-amino-4,6-dioxo-1H-pyrimidin-5-yl)carbamoylazanium |
|---|---|
| PubChem CID | 163798365 |
| Molecular Formula | C5H8N5O3+ |
| Molecular Weight | 186.15 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | (2-amino-4,6-dioxo-1H-pyrimidin-5-yl)carbamoylazanium |
| SMILES | NC1=NC(=O)C(NC([NH3+])=O)C(=O)N1 |
| InChI | InChI=1S/C5H7N5O3/c6-4-9-2(11)1(3(12)10-4)8-5(7)13/h1H,(H3,7,8,13)(H3,6,9,10,11,12)/p+1 |
| InChIKey | NCULITOVIKCFNW-UHFFFAOYSA-O |
| XLogP | -3.72 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.15 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|