C18H15NO4S2 — CID 163804195
3-[[4-[(E)-(4-oxo-2-sulfanyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 163804195) has the molecular formula C18H15NO4S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-[[4-[(E)-(4-oxo-2-sulfanyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(E)-(4-oxo-2-sulfanyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 163804195 |
| Molecular Formula | C18H15NO4S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 3-[[4-[(E)-(4-oxo-2-sulfanyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1NC(S)S/C1=C/c1ccc(OCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H15NO4S2/c20-16-15(25-18(24)19-16)9-11-4-6-14(7-5-11)23-10-12-2-1-3-13(8-12)17(21)22/h1-9,18,24H,10H2,(H,19,20)(H,21,22)/b15-9+ |
| InChIKey | NHORREWSTNEYPM-OQLLNIDSSA-N |
| XLogP | 3.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|