C20H16NO5S- — CID 2186801
3-[[4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate (PubChem CID 2186801) has the molecular formula C20H16NO5S- and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[[4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate.
| Compound Name | 3-[[4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 2186801 |
| Molecular Formula | C20H16NO5S- |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3-[[4-[(E)-(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate |
| SMILES | CCN1C(=O)S/C(=C/c2ccc(OCc3cccc(C(=O)[O-])c3)cc2)C1=O |
| InChI | InChI=1S/C20H17NO5S/c1-2-21-18(22)17(27-20(21)25)11-13-6-8-16(9-7-13)26-12-14-4-3-5-15(10-14)19(23)24/h3-11H,2,12H2,1H3,(H,23,24)/p-1/b17-11+ |
| InChIKey | VDBLPWPLIRETBT-GZTJUZNOSA-M |
| XLogP | 2.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|