C21H14NO5S- — CID 7872690
3-[[4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate (PubChem CID 7872690) has the molecular formula C21H14NO5S- and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-[[4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate.
| Compound Name | 3-[[4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 7872690 |
| Molecular Formula | C21H14NO5S- |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-[[4-[(Z)-(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoate |
| SMILES | C#CCN1C(=O)S/C(=C\c2ccc(OCc3cccc(C(=O)[O-])c3)cc2)C1=O |
| InChI | InChI=1S/C21H15NO5S/c1-2-10-22-19(23)18(28-21(22)26)12-14-6-8-17(9-7-14)27-13-15-4-3-5-16(11-15)20(24)25/h1,3-9,11-12H,10,13H2,(H,24,25)/p-1/b18-12- |
| InChIKey | QRVGUBKWWROZPL-PDGQHHTCSA-M |
| XLogP | 2.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|