C11H22N2 — CID 163804846
1-[(2S)-butan-2-yl]-1-methyl-2-[(3Z)-3-methylpenta-1,3-dien-2-yl]hydrazine (PubChem CID 163804846) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-1-methyl-2-[(3Z)-3-methylpenta-1,3-dien-2-yl]hydrazine.
| Compound Name | 1-[(2S)-butan-2-yl]-1-methyl-2-[(3Z)-3-methylpenta-1,3-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 163804846 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-1-methyl-2-[(3Z)-3-methylpenta-1,3-dien-2-yl]hydrazine |
| SMILES | C=C(NN(C)[C@@H](C)CC)/C(C)=C\C |
| InChI | InChI=1S/C11H22N2/c1-7-9(3)11(5)12-13(6)10(4)8-2/h7,10,12H,5,8H2,1-4,6H3/b9-7-/t10-/m0/s1 |
| InChIKey | NIDVKVJRBZCTTH-RNKPRXRFSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|