C14H33N3 — CID 143501967
ethane;(3E)-N,N,5-trimethyl-4-(2-methylhydrazinyl)hexa-3,5-dien-2-amine (PubChem CID 143501967) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is ethane;(3E)-N,N,5-trimethyl-4-(2-methylhydrazinyl)hexa-3,5-dien-2-amine.
| Compound Name | ethane;(3E)-N,N,5-trimethyl-4-(2-methylhydrazinyl)hexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 143501967 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | ethane;(3E)-N,N,5-trimethyl-4-(2-methylhydrazinyl)hexa-3,5-dien-2-amine |
| SMILES | C=C(C)/C(=C\C(C)N(C)C)NNC.CC.CC |
| InChI | InChI=1S/C10H21N3.2C2H6/c1-8(2)10(12-11-4)7-9(3)13(5)6;2*1-2/h7,9,11-12H,1H2,2-6H3;2*1-2H3/b10-7+;; |
| InChIKey | QFZZREFGQOPVPZ-WRQJSNHTSA-N |
| XLogP | 3.17 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|