C15H34N6+2 — CID 163939991
methyl-bis(methylamino)-[(2Z,4E,6Z)-1-[methyl-bis(methylamino)azaniumyl]nona-2,4,6-trien-5-yl]azanium (PubChem CID 163939991) has the molecular formula C15H34N6+2 and a molecular weight of 298.48 g/mol. Its IUPAC name is methyl-bis(methylamino)-[(2Z,4E,6Z)-1-[methyl-bis(methylamino)azaniumyl]nona-2,4,6-trien-5-yl]azanium.
| Compound Name | methyl-bis(methylamino)-[(2Z,4E,6Z)-1-[methyl-bis(methylamino)azaniumyl]nona-2,4,6-trien-5-yl]azanium |
|---|---|
| PubChem CID | 163939991 |
| Molecular Formula | C15H34N6+2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.28 |
| IUPAC Name | methyl-bis(methylamino)-[(2Z,4E,6Z)-1-[methyl-bis(methylamino)azaniumyl]nona-2,4,6-trien-5-yl]azanium |
| SMILES | CC/C=C\C(=C/C=C\C[N+](C)(NC)NC)[N+](C)(NC)NC |
| InChI | InChI=1S/C15H34N6/c1-8-9-12-15(21(7,18-4)19-5)13-10-11-14-20(6,16-2)17-3/h9-13,16-19H,8,14H2,1-7H3/q+2/b11-10-,12-9-,15-13+ |
| InChIKey | YBAOAGTUXXXMNR-RANUFIPJSA-N |
| XLogP | 0.82 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|