C8H16N4 — CID 145152765
(3E)-5-hydrazinyl-1-N-methyl-2-methylidenehexa-3,5-diene-1,4-diamine (PubChem CID 145152765) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3E)-5-hydrazinyl-1-N-methyl-2-methylidenehexa-3,5-diene-1,4-diamine.
| Compound Name | (3E)-5-hydrazinyl-1-N-methyl-2-methylidenehexa-3,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 145152765 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | (3E)-5-hydrazinyl-1-N-methyl-2-methylidenehexa-3,5-diene-1,4-diamine |
| SMILES | C=C(/C=C(/N)C(=C)NN)CNC |
| InChI | InChI=1S/C8H16N4/c1-6(5-11-3)4-8(9)7(2)12-10/h4,11-12H,1-2,5,9-10H2,3H3/b8-4+ |
| InChIKey | YCKPUZRXDDITQZ-XBXARRHUSA-N |
| XLogP | -0.42 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|