C7H9N3O2 — CID 163807481
N-methyl-1-(5-nitro-3,4-dihydropyridin-2-yl)methanimine (PubChem CID 163807481) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is N-methyl-1-(5-nitro-3,4-dihydropyridin-2-yl)methanimine.
| Compound Name | N-methyl-1-(5-nitro-3,4-dihydropyridin-2-yl)methanimine |
|---|---|
| PubChem CID | 163807481 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | N-methyl-1-(5-nitro-3,4-dihydropyridin-2-yl)methanimine |
| SMILES | C/N=C/C1=NC=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C7H9N3O2/c1-8-4-6-2-3-7(5-9-6)10(11)12/h4-5H,2-3H2,1H3/b8-4+ |
| InChIKey | NKGZNAXCKLGMQJ-XBXARRHUSA-N |
| XLogP | 1.04 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|