C19H10F5S+ — CID 163816799
2,8-difluoro-5-[4-(trifluoromethyl)phenyl]dibenzothiophen-5-ium (PubChem CID 163816799) has the molecular formula C19H10F5S+ and a molecular weight of 365.35 g/mol. Its IUPAC name is 2,8-difluoro-5-[4-(trifluoromethyl)phenyl]dibenzothiophen-5-ium.
| Compound Name | 2,8-difluoro-5-[4-(trifluoromethyl)phenyl]dibenzothiophen-5-ium |
|---|---|
| PubChem CID | 163816799 |
| Molecular Formula | C19H10F5S+ |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2,8-difluoro-5-[4-(trifluoromethyl)phenyl]dibenzothiophen-5-ium |
| SMILES | Fc1ccc2c(c1)c1cc(F)ccc1[s+]2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H10F5S/c20-12-3-7-17-15(9-12)16-10-13(21)4-8-18(16)25(17)14-5-1-11(2-6-14)19(22,23)24/h1-10H/q+1 |
| InChIKey | NSALFMHLDOLUEE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|