C11H17NO — CID 163818708
(1R)-4-piperidin-4-ylcyclohexa-2,4-dien-1-ol (PubChem CID 163818708) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (1R)-4-piperidin-4-ylcyclohexa-2,4-dien-1-ol.
| Compound Name | (1R)-4-piperidin-4-ylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 163818708 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1R)-4-piperidin-4-ylcyclohexa-2,4-dien-1-ol |
| SMILES | O[C@H]1C=CC(C2CCNCC2)=CC1 |
| InChI | InChI=1S/C11H17NO/c13-11-3-1-9(2-4-11)10-5-7-12-8-6-10/h1-3,10-13H,4-8H2/t11-/m0/s1 |
| InChIKey | NTOMAVMYWLWQKQ-NSHDSACASA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |