C6H12N2S — CID 163826271
2-ethylsulfanyl-1-methyl-4,5-dihydroimidazole (PubChem CID 163826271) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-methyl-4,5-dihydroimidazole.
| Compound Name | 2-ethylsulfanyl-1-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 163826271 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-ethylsulfanyl-1-methyl-4,5-dihydroimidazole |
| SMILES | CCSC1=NCCN1C |
| InChI | InChI=1S/C6H12N2S/c1-3-9-6-7-4-5-8(6)2/h3-5H2,1-2H3 |
| InChIKey | NZTLYTKMUVDLST-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |